상품명칭 |
2,2'-[(1-methylpropane-1,3-diyl)bis(oxy)]bis[4-methyl-1,3,2-dioxaborinane] |
영문 이름 |
2,2'-[(1-methylpropane-1,3-diyl)bis(oxy)]bis[4-methyl-1,3,2-dioxaborinane]; 1,3,2-Dioxaborinane, 2,2'-((1-methyl-1,3-propanediyl)bis(oxy))bis(4-methyl-; 1,3-Butanediol, cyclic ester with boric acid, 1-methyltrimethylene ester; CCRIS 808; NSC 526740; 1,3-Butanediol, cyclic ester with boric acid (H3BO3), 1-methyltrimethylene ester (8CI); 2,2'-((1-Methylpropane-1,3-diyl)bis(oxy))bis(4-methyl-1,3,2-dioxaborinane); Biobor jf; 2,2'-[butane-1,3-diylbis(oxy)]bis(4-methyl-1,3,2-dioxaborinane) |
분자식 |
C12H24B2O6 |
분자량 |
285.9374 |
InChI |
InChI=1/C12H24B2O6/c1-10-4-7-15-13(18-10)16-8-5-11(2)19-14-17-9-6-12(3)20-14/h10-12H,4-9H2,1-3H3 |
cas번호 |
2665-13-6 |
EC번호 |
220-198-4 |
분자 구조 |
|
밀도 |
1.05g/cm3 |
비등점 |
279.5°C at 760 mmHg |
굴절 지수 |
1.433 |
인화점 |
122.8°C |
증기압 |
0.0068mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|